C23H25ClN4 — CID 10111148
13-chloro-2-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 10111148) has the molecular formula C23H25ClN4 and a molecular weight of 392.93 g/mol. Its IUPAC name is 13-chloro-2-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | 13-chloro-2-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 10111148 |
| Molecular Formula | C23H25ClN4 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 13-chloro-2-[(3S)-3-(imidazol-1-ylmethyl)piperidin-1-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | Clc1ccc2c(c1)CCc1cccnc1C2N1CCC[C@H](Cn2ccnc2)C1 |
| InChI | InChI=1S/C23H25ClN4/c24-20-7-8-21-19(13-20)6-5-18-4-1-9-26-22(18)23(21)28-11-2-3-17(15-28)14-27-12-10-25-16-27/h1,4,7-10,12-13,16-17,23H,2-3,5-6,11,14-15H2/t17-,23?/m1/s1 |
| InChIKey | MTRKFNHAQDTPOP-LIXIDFRTSA-N |
| XLogP | 4.53 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |