About (6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one
(6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one (PubChem CID 101111949) has the molecular formula C21H36FNO2Si
and a molecular weight of 381.61 g/mol. Its IUPAC name is (6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one.
Molecular Properties
| Compound Name | (6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one |
| PubChem CID | 101111949 |
| Molecular Formula | C21H36FNO2Si |
| Molecular Weight | 381.61 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | (6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one |
| SMILES | CC(C)(C)C(=O)CC[C@@H](CO[Si](C)(C)C(C)(C)C)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H36FNO2Si/c1-20(2,3)19(24)14-13-18(15-25-26(7,8)21(4,5)6)23-17-11-9-16(22)10-12-17/h9-12,18,23H,13-15H2,1-8H3/t18-/m0/s1 |
| InChIKey | HQQLJFNHEIVRPU-SFHVURJKSA-N |
| XLogP | 6.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one?
The IUPAC name of (6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one (CID 101111949) is (6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one.
What is the SMILES notation for (6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one?
The canonical SMILES for (6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one is CC(C)(C)C(=O)CC[C@@H](CO[Si](C)(C)C(C)(C)C)Nc1ccc(F)cc1.
What is the InChIKey of (6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one?
The InChIKey is HQQLJFNHEIVRPU-SFHVURJKSA-N. The full InChI is InChI=1S/C21H36FNO2Si/c1-20(2,3)19(24)14-13-18(15-25-26(7,8)21(4,5)6)23-17-11-9-16(22)10-12-17/h9-12,18,23H,13-15H2,1-8H3/t18-/m0/s1.
What are the key properties of (6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one?
(6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one has a molecular weight of 381.61 g/mol, XLogP of 6.02, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluoroanilino)-2,2-dimethylheptan-3-one is sourced from PubChem (CID 101111949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).