About 2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol
2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol (PubChem CID 101112031) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol.
Molecular Properties
| Compound Name | 2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol |
| PubChem CID | 101112031 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol |
| SMILES | C=C(CO)[C@@H](C)[C@H](Nc1ccccc1O)c1ccccc1 |
| InChI | InChI=1S/C18H21NO2/c1-13(12-20)14(2)18(15-8-4-3-5-9-15)19-16-10-6-7-11-17(16)21/h3-11,14,18-21H,1,12H2,2H3/t14-,18+/m1/s1 |
| InChIKey | YXUWJYYNVBHXKO-KDOFPFPSSA-N |
| XLogP | 3.73 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol?
The IUPAC name of 2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol (CID 101112031) is 2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol.
What is the SMILES notation for 2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol?
The canonical SMILES for 2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol is C=C(CO)[C@@H](C)[C@H](Nc1ccccc1O)c1ccccc1.
What is the InChIKey of 2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol?
The InChIKey is YXUWJYYNVBHXKO-KDOFPFPSSA-N. The full InChI is InChI=1S/C18H21NO2/c1-13(12-20)14(2)18(15-8-4-3-5-9-15)19-16-10-6-7-11-17(16)21/h3-11,14,18-21H,1,12H2,2H3/t14-,18+/m1/s1.
What are the key properties of 2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol?
2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol has a molecular weight of 283.37 g/mol, XLogP of 3.73, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1S,2R)-3-(hydroxymethyl)-2-methyl-1-phenylbut-3-enyl]amino]phenol is sourced from PubChem (CID 101112031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).