About [6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone
[6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone (PubChem CID 10111212) has the molecular formula C21H16F2N4O2
and a molecular weight of 394.38 g/mol. Its IUPAC name is [6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone.
Molecular Properties
| Compound Name | [6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone |
| PubChem CID | 10111212 |
| Molecular Formula | C21H16F2N4O2 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone |
| SMILES | COc1cc2nc(C)[nH]c2cc1C(=O)c1ccc(Nc2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C21H16F2N4O2/c1-11-25-17-8-14(19(29-2)9-18(17)26-11)21(28)12-3-6-20(24-10-12)27-16-5-4-13(22)7-15(16)23/h3-10H,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | BLCPCYACPKGWKW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone?
The IUPAC name of [6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone (CID 10111212) is [6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone.
What is the SMILES notation for [6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone?
The canonical SMILES for [6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone is COc1cc2nc(C)[nH]c2cc1C(=O)c1ccc(Nc2ccc(F)cc2F)nc1.
What is the InChIKey of [6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone?
The InChIKey is BLCPCYACPKGWKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F2N4O2/c1-11-25-17-8-14(19(29-2)9-18(17)26-11)21(28)12-3-6-20(24-10-12)27-16-5-4-13(22)7-15(16)23/h3-10H,1-2H3,(H,24,27)(H,25,26).
What are the key properties of [6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone?
[6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone has a molecular weight of 394.38 g/mol, XLogP of 4.53, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2,4-difluoroanilino)-3-pyridinyl]-(6-methoxy-2-methyl-3H-benzimidazol-5-yl)methanone is sourced from PubChem (CID 10111212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).