C14H17ClF2N2O — CID 101112409
(2R)-1-chloro-3-(4,5-dihydro-1,3-oxazol-2-yl)-1,1-difluoro-N-[(1S)-1-phenylethyl]propan-2-amine (PubChem CID 101112409) has the molecular formula C14H17ClF2N2O and a molecular weight of 302.75 g/mol. Its IUPAC name is (2R)-1-chloro-3-(4,5-dihydro-1,3-oxazol-2-yl)-1,1-difluoro-N-[(1S)-1-phenylethyl]propan-2-amine.
| Compound Name | (2R)-1-chloro-3-(4,5-dihydro-1,3-oxazol-2-yl)-1,1-difluoro-N-[(1S)-1-phenylethyl]propan-2-amine |
|---|---|
| PubChem CID | 101112409 |
| Molecular Formula | C14H17ClF2N2O |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (2R)-1-chloro-3-(4,5-dihydro-1,3-oxazol-2-yl)-1,1-difluoro-N-[(1S)-1-phenylethyl]propan-2-amine |
| SMILES | C[C@H](N[C@H](CC1=NCCO1)C(F)(F)Cl)c1ccccc1 |
| InChI | InChI=1S/C14H17ClF2N2O/c1-10(11-5-3-2-4-6-11)19-12(14(15,16)17)9-13-18-7-8-20-13/h2-6,10,12,19H,7-9H2,1H3/t10-,12+/m0/s1 |
| InChIKey | TZKLLQZDADJPMJ-CMPLNLGQSA-N |
| XLogP | 3.36 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|