C15H15Cl2N3O7S2 — CID 101113201
(2S,3R)-3-[(2,3-dichloro-4,6-disulfamoylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 101113201) has the molecular formula C15H15Cl2N3O7S2 and a molecular weight of 484.34 g/mol. Its IUPAC name is (2S,3R)-3-[(2,3-dichloro-4,6-disulfamoylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (2S,3R)-3-[(2,3-dichloro-4,6-disulfamoylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 101113201 |
| Molecular Formula | C15H15Cl2N3O7S2 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 482.97 |
| IUPAC Name | (2S,3R)-3-[(2,3-dichloro-4,6-disulfamoylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | NS(=O)(=O)c1cc(S(N)(=O)=O)c(NC(=O)[C@@H]2C3C=CC(C3)[C@@H]2C(=O)O)c(Cl)c1Cl |
| InChI | InChI=1S/C15H15Cl2N3O7S2/c16-11-7(28(18,24)25)4-8(29(19,26)27)13(12(11)17)20-14(21)9-5-1-2-6(3-5)10(9)15(22)23/h1-2,4-6,9-10H,3H2,(H,20,21)(H,22,23)(H2,18,24,25)(H2,19,26,27)/t5?,6?,9-,10+/m1/s1 |
| InChIKey | OEOWRPQULJAFQM-MIOKAVIOSA-N |
| XLogP | 0.75 |
| TPSA | 186.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|