C30H60O4Si2 — CID 101113261
(3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,4,6,8-tetramethyltetradec-12-yn-5-one (PubChem CID 101113261) has the molecular formula C30H60O4Si2 and a molecular weight of 540.98 g/mol. Its IUPAC name is (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,4,6,8-tetramethyltetradec-12-yn-5-one.
| Compound Name | (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,4,6,8-tetramethyltetradec-12-yn-5-one |
|---|---|
| PubChem CID | 101113261 |
| Molecular Formula | C30H60O4Si2 |
| Molecular Weight | 540.98 g/mol |
| Exact Mass | 540.40 |
| IUPAC Name | (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,4,6,8-tetramethyltetradec-12-yn-5-one |
| SMILES | CC#CCCC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H60O4Si2/c1-16-17-18-19-20-23(2)26(34-36(14,15)29(7,8)9)24(3)27(32)30(10,11)25(21-22-31)33-35(12,13)28(4,5)6/h23-26,31H,18-22H2,1-15H3/t23-,24+,25-,26-/m0/s1 |
| InChIKey | SRZCWFDKTTUJEV-QYOOZWMWSA-N |
| XLogP | 8.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.98 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|