C22H20O5 — CID 101113502
methyl (2R)-2-(15-methoxycarbonyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)oxirane-2-carboxylate (PubChem CID 101113502) has the molecular formula C22H20O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl (2R)-2-(15-methoxycarbonyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)oxirane-2-carboxylate.
| Compound Name | methyl (2R)-2-(15-methoxycarbonyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 101113502 |
| Molecular Formula | C22H20O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | methyl (2R)-2-(15-methoxycarbonyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)oxirane-2-carboxylate |
| SMILES | COC(=O)C1([C@]2(C(=O)OC)CO2)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C22H20O5/c1-25-19(23)21(22(12-27-22)20(24)26-2)11-17-13-7-3-5-9-15(13)18(21)16-10-6-4-8-14(16)17/h3-10,17-18H,11-12H2,1-2H3/t17?,18?,21?,22-/m1/s1 |
| InChIKey | XKONAJBSSOKGFV-HGNWCAPWSA-N |
| XLogP | 2.77 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|