C18H30O3 — CID 101113594
4-[(1R,2R,4S,4aS,8aS)-4-hydroxy-5,5,8a-trimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]butan-2-one (PubChem CID 101113594) has the molecular formula C18H30O3 and a molecular weight of 294.43 g/mol. Its IUPAC name is 4-[(1R,2R,4S,4aS,8aS)-4-hydroxy-5,5,8a-trimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]butan-2-one.
| Compound Name | 4-[(1R,2R,4S,4aS,8aS)-4-hydroxy-5,5,8a-trimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]butan-2-one |
|---|---|
| PubChem CID | 101113594 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 4-[(1R,2R,4S,4aS,8aS)-4-hydroxy-5,5,8a-trimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]butan-2-one |
| SMILES | CC(=O)CC[C@H]1[C@@]2(CO2)C[C@H](O)[C@H]2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C18H30O3/c1-12(19)6-7-14-17(4)9-5-8-16(2,3)15(17)13(20)10-18(14)11-21-18/h13-15,20H,5-11H2,1-4H3/t13-,14+,15-,17+,18-/m0/s1 |
| InChIKey | YGWSNBDWWIKCDR-FZMWSMFESA-N |
| XLogP | 3.34 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|