About cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate
cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate (PubChem CID 101113638) has the molecular formula C23H29FO3Si
and a molecular weight of 400.57 g/mol. Its IUPAC name is cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate |
| PubChem CID | 101113638 |
| Molecular Formula | C23H29FO3Si |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(F)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H29FO3Si/c1-5-26-21(25)23(24)16-18(23)17-27-28(22(2,3)4,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,18H,5,16-17H2,1-4H3/t18-,23-/m0/s1 |
| InChIKey | XJEXASYPWJEWEA-MBSDFSHPSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate?
The IUPAC name of cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate (CID 101113638) is cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate.
What is the SMILES notation for cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate?
The canonical SMILES for cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate is CCOC(=O)[C@]1(F)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate?
The InChIKey is XJEXASYPWJEWEA-MBSDFSHPSA-N. The full InChI is InChI=1S/C23H29FO3Si/c1-5-26-21(25)23(24)16-18(23)17-27-28(22(2,3)4,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,18H,5,16-17H2,1-4H3/t18-,23-/m0/s1.
What are the key properties of cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate?
cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate has a molecular weight of 400.57 g/mol, XLogP of 3.85, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropane-1-carboxylate is sourced from PubChem (CID 101113638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).