About 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid
2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid (PubChem CID 10111372) has the molecular formula C25H29FO3
and a molecular weight of 396.50 g/mol. Its IUPAC name is 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid |
| PubChem CID | 10111372 |
| Molecular Formula | C25H29FO3 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid |
| SMILES | COc1c(C(C)(C)C)cc(C#Cc2ccc(CC(=O)O)c(F)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C25H29FO3/c1-24(2,3)19-12-17(13-20(23(19)29-7)25(4,5)6)9-8-16-10-11-18(15-22(27)28)21(26)14-16/h10-14H,15H2,1-7H3,(H,27,28) |
| InChIKey | OHXOJSLDGUQQAS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid?
The IUPAC name of 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid (CID 10111372) is 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid.
What is the SMILES notation for 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid?
The canonical SMILES for 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid is COc1c(C(C)(C)C)cc(C#Cc2ccc(CC(=O)O)c(F)c2)cc1C(C)(C)C.
What is the InChIKey of 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid?
The InChIKey is OHXOJSLDGUQQAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29FO3/c1-24(2,3)19-12-17(13-20(23(19)29-7)25(4,5)6)9-8-16-10-11-18(15-22(27)28)21(26)14-16/h10-14H,15H2,1-7H3,(H,27,28).
What are the key properties of 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid?
2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid has a molecular weight of 396.50 g/mol, XLogP of 5.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]-2-fluorophenyl]acetic acid is sourced from PubChem (CID 10111372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).