C24H30O3 — CID 101114396
(3S,5R)-3-hydroxy-4,5-bis[(2,4,6-trimethylphenyl)methyl]oxolan-2-one (PubChem CID 101114396) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is (3S,5R)-3-hydroxy-4,5-bis[(2,4,6-trimethylphenyl)methyl]oxolan-2-one.
| Compound Name | (3S,5R)-3-hydroxy-4,5-bis[(2,4,6-trimethylphenyl)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 101114396 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (3S,5R)-3-hydroxy-4,5-bis[(2,4,6-trimethylphenyl)methyl]oxolan-2-one |
| SMILES | Cc1cc(C)c(CC2[C@H](O)C(=O)O[C@@H]2Cc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C24H30O3/c1-13-7-15(3)19(16(4)8-13)11-21-22(27-24(26)23(21)25)12-20-17(5)9-14(2)10-18(20)6/h7-10,21-23,25H,11-12H2,1-6H3/t21?,22-,23+/m1/s1 |
| InChIKey | XLQJRSLZSFQUOW-NRSZHQCHSA-N |
| XLogP | 4.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |