C17H22O3 — CID 101114413
(1S,3R,4R,7R)-3,7-diethoxy-1-phenyl-2-oxabicyclo[2.2.2]oct-5-ene (PubChem CID 101114413) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (1S,3R,4R,7R)-3,7-diethoxy-1-phenyl-2-oxabicyclo[2.2.2]oct-5-ene.
| Compound Name | (1S,3R,4R,7R)-3,7-diethoxy-1-phenyl-2-oxabicyclo[2.2.2]oct-5-ene |
|---|---|
| PubChem CID | 101114413 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (1S,3R,4R,7R)-3,7-diethoxy-1-phenyl-2-oxabicyclo[2.2.2]oct-5-ene |
| SMILES | CCO[C@@H]1O[C@]2(c3ccccc3)C=C[C@H]1C[C@H]2OCC |
| InChI | InChI=1S/C17H22O3/c1-3-18-15-12-13-10-11-17(15,20-16(13)19-4-2)14-8-6-5-7-9-14/h5-11,13,15-16H,3-4,12H2,1-2H3/t13-,15+,16+,17-/m0/s1 |
| InChIKey | HJJGFBDIOYOSCD-SVGFKBNWSA-N |
| XLogP | 3.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|