C19H32O5Si — CID 101114506
(3R,3aR,6R,7aR)-6-[(2S)-2,4,4-trimethyl-1,3-dioxolan-2-yl]-3-[(1S)-1-trimethylsilyloxyethyl]-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 101114506) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is (3R,3aR,6R,7aR)-6-[(2S)-2,4,4-trimethyl-1,3-dioxolan-2-yl]-3-[(1S)-1-trimethylsilyloxyethyl]-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aR,6R,7aR)-6-[(2S)-2,4,4-trimethyl-1,3-dioxolan-2-yl]-3-[(1S)-1-trimethylsilyloxyethyl]-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 101114506 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (3R,3aR,6R,7aR)-6-[(2S)-2,4,4-trimethyl-1,3-dioxolan-2-yl]-3-[(1S)-1-trimethylsilyloxyethyl]-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | C[C@H](O[Si](C)(C)C)[C@@H]1OC(=O)[C@@H]2C[C@@H]([C@@]3(C)OCC(C)(C)O3)C=C[C@@H]12 |
| InChI | InChI=1S/C19H32O5Si/c1-12(23-25(5,6)7)16-14-9-8-13(10-15(14)17(20)22-16)19(4)21-11-18(2,3)24-19/h8-9,12-16H,10-11H2,1-7H3/t12-,13-,14+,15+,16-,19-/m0/s1 |
| InChIKey | AGFNTQNUJVFRIF-GTPBXFKWSA-N |
| XLogP | 3.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|