C22H38O5Si — CID 101114509
(3R,3aR,6R,7aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[(2S)-2,4,4-trimethyl-1,3-dioxolan-2-yl]-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 101114509) has the molecular formula C22H38O5Si and a molecular weight of 410.63 g/mol. Its IUPAC name is (3R,3aR,6R,7aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[(2S)-2,4,4-trimethyl-1,3-dioxolan-2-yl]-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aR,6R,7aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[(2S)-2,4,4-trimethyl-1,3-dioxolan-2-yl]-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 101114509 |
| Molecular Formula | C22H38O5Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (3R,3aR,6R,7aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[(2S)-2,4,4-trimethyl-1,3-dioxolan-2-yl]-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(=O)[C@H]2C[C@@H]([C@@]3(C)OCC(C)(C)O3)C=C[C@@H]12 |
| InChI | InChI=1S/C22H38O5Si/c1-14(26-28(8,9)20(2,3)4)18-16-11-10-15(12-17(16)19(23)25-18)22(7)24-13-21(5,6)27-22/h10-11,14-18H,12-13H2,1-9H3/t14-,15-,16+,17-,18-,22-/m0/s1 |
| InChIKey | PMXDBVIBJQNLCL-JAPYSXKMSA-N |
| XLogP | 4.67 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|