C30H60O3 — CID 101114941
2,4,6-tris(2,6-dimethylheptyl)-1,3,5-trioxane (PubChem CID 101114941) has the molecular formula C30H60O3 and a molecular weight of 468.81 g/mol. Its IUPAC name is 2,4,6-tris(2,6-dimethylheptyl)-1,3,5-trioxane.
| Compound Name | 2,4,6-tris(2,6-dimethylheptyl)-1,3,5-trioxane |
|---|---|
| PubChem CID | 101114941 |
| Molecular Formula | C30H60O3 |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.45 |
| IUPAC Name | 2,4,6-tris(2,6-dimethylheptyl)-1,3,5-trioxane |
| SMILES | CC(C)CCCC(C)CC1OC(CC(C)CCCC(C)C)OC(CC(C)CCCC(C)C)O1 |
| InChI | InChI=1S/C30H60O3/c1-22(2)13-10-16-25(7)19-28-31-29(20-26(8)17-11-14-23(3)4)33-30(32-28)21-27(9)18-12-15-24(5)6/h22-30H,10-21H2,1-9H3 |
| InChIKey | IQVNLKGCEDTBTJ-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |