C34H73IO3Si3 — CID 101115063
[(E,1R,6S,7S)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(2R)-1-iodopropan-2-yl]-4,6-dimethylundec-3-enoxy]-triethylsilane (PubChem CID 101115063) has the molecular formula C34H73IO3Si3 and a molecular weight of 741.12 g/mol. Its IUPAC name is [(E,1R,6S,7S)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(2R)-1-iodopropan-2-yl]-4,6-dimethylundec-3-enoxy]-triethylsilane.
| Compound Name | [(E,1R,6S,7S)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(2R)-1-iodopropan-2-yl]-4,6-dimethylundec-3-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 101115063 |
| Molecular Formula | C34H73IO3Si3 |
| Molecular Weight | 741.12 g/mol |
| Exact Mass | 740.39 |
| IUPAC Name | [(E,1R,6S,7S)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(2R)-1-iodopropan-2-yl]-4,6-dimethylundec-3-enoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H](C/C=C(\C)C[C@H](C)[C@H](CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](C)CI |
| InChI | InChI=1S/C34H73IO3Si3/c1-17-41(18-2,19-3)38-32(30(6)27-35)24-23-28(4)26-29(5)31(37-40(15,16)34(10,11)12)22-20-21-25-36-39(13,14)33(7,8)9/h23,29-32H,17-22,24-27H2,1-16H3/b28-23+/t29-,30-,31-,32+/m0/s1 |
| InChIKey | PLXBSOBPCQJXTJ-KUGRPLMBSA-N |
| XLogP | 12.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.12 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|