C20H21NO3 — CID 101115156
(3aS,7S)-2-(2,4-dimethylphenyl)-7-phenyl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one (PubChem CID 101115156) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (3aS,7S)-2-(2,4-dimethylphenyl)-7-phenyl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one.
| Compound Name | (3aS,7S)-2-(2,4-dimethylphenyl)-7-phenyl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 101115156 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (3aS,7S)-2-(2,4-dimethylphenyl)-7-phenyl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one |
| SMILES | Cc1ccc(C2C[C@H]3C(=O)OC[C@H](c4ccccc4)N3O2)c(C)c1 |
| InChI | InChI=1S/C20H21NO3/c1-13-8-9-16(14(2)10-13)19-11-17-20(22)23-12-18(21(17)24-19)15-6-4-3-5-7-15/h3-10,17-19H,11-12H2,1-2H3/t17-,18+,19?/m0/s1 |
| InChIKey | XNGQMHNPAIGHLW-PAMZHZACSA-N |
| XLogP | 3.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |