C17H34O3Si — CID 101115180
(1S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-ol (PubChem CID 101115180) has the molecular formula C17H34O3Si and a molecular weight of 314.54 g/mol. Its IUPAC name is (1S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-ol.
| Compound Name | (1S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 101115180 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (1S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-ol |
| SMILES | CC[C@]1(O)C=C[C@@H](OC(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O3Si/c1-10-17(18)12-11-13(19-15(2,3)4)14(17)20-21(8,9)16(5,6)7/h11-14,18H,10H2,1-9H3/t13-,14+,17+/m1/s1 |
| InChIKey | GIFPSZHOXSTKKM-KEYYUXOJSA-N |
| XLogP | 4.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|