About 4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile
4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile (PubChem CID 10111535) has the molecular formula C23H21N5O2
and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile.
Molecular Properties
| Compound Name | 4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile |
| PubChem CID | 10111535 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile |
| SMILES | N#CCCCn1c(Cn2c(=O)n(C3CC3)c(=O)c3ccccc32)nc2ccccc21 |
| InChI | InChI=1S/C23H21N5O2/c24-13-5-6-14-26-20-10-4-2-8-18(20)25-21(26)15-27-19-9-3-1-7-17(19)22(29)28(23(27)30)16-11-12-16/h1-4,7-10,16H,5-6,11-12,14-15H2 |
| InChIKey | KOZSNNUPDRXPEN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile?
The IUPAC name of 4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile (CID 10111535) is 4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile.
What is the SMILES notation for 4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile?
The canonical SMILES for 4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile is N#CCCCn1c(Cn2c(=O)n(C3CC3)c(=O)c3ccccc32)nc2ccccc21.
What is the InChIKey of 4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile?
The InChIKey is KOZSNNUPDRXPEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N5O2/c24-13-5-6-14-26-20-10-4-2-8-18(20)25-21(26)15-27-19-9-3-1-7-17(19)22(29)28(23(27)30)16-11-12-16/h1-4,7-10,16H,5-6,11-12,14-15H2.
What are the key properties of 4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile?
4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile has a molecular weight of 399.45 g/mol, XLogP of 3.20, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(3-cyclopropyl-2,4-dioxoquinazolin-1-yl)methyl]benzimidazol-1-yl]butanenitrile is sourced from PubChem (CID 10111535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).