About N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide
N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide (PubChem CID 10111541) has the molecular formula C20H21N3O4S
and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide.
Molecular Properties
| Compound Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide |
| PubChem CID | 10111541 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)Cc2cccs2)ccc1-c1cnco1 |
| InChI | InChI=1S/C20H21N3O4S/c1-20(2,10-14-5-4-8-28-14)23-19(25)18(24)22-13-6-7-15(16(9-13)26-3)17-11-21-12-27-17/h4-9,11-12H,10H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | WZDIRROKPILLMT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide?
The IUPAC name of N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide (CID 10111541) is N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide.
What is the SMILES notation for N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide?
The canonical SMILES for N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide is COc1cc(NC(=O)C(=O)NC(C)(C)Cc2cccs2)ccc1-c1cnco1.
What is the InChIKey of N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide?
The InChIKey is WZDIRROKPILLMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O4S/c1-20(2,10-14-5-4-8-28-14)23-19(25)18(24)22-13-6-7-15(16(9-13)26-3)17-11-21-12-27-17/h4-9,11-12H,10H2,1-3H3,(H,22,24)(H,23,25).
What are the key properties of N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide?
N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide has a molecular weight of 399.47 g/mol, XLogP of 3.49, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-(2-methyl-1-thiophen-2-ylpropan-2-yl)oxamide is sourced from PubChem (CID 10111541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).