C26H40O7Si — CID 101116088
4-acetyloxy-2-[[(2R,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-2-hydroxypent-4-enyl]oxan-2-yl]methyl]benzoic acid (PubChem CID 101116088) has the molecular formula C26H40O7Si and a molecular weight of 492.69 g/mol. Its IUPAC name is 4-acetyloxy-2-[[(2R,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-2-hydroxypent-4-enyl]oxan-2-yl]methyl]benzoic acid.
| Compound Name | 4-acetyloxy-2-[[(2R,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-2-hydroxypent-4-enyl]oxan-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 101116088 |
| Molecular Formula | C26H40O7Si |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 4-acetyloxy-2-[[(2R,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-2-hydroxypent-4-enyl]oxan-2-yl]methyl]benzoic acid |
| SMILES | C=CC[C@@H](O)C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](Cc2cc(OC(C)=O)ccc2C(=O)O)O1 |
| InChI | InChI=1S/C26H40O7Si/c1-8-9-19(28)14-22-16-23(33-34(6,7)26(3,4)5)15-21(32-22)13-18-12-20(31-17(2)27)10-11-24(18)25(29)30/h8,10-12,19,21-23,28H,1,9,13-16H2,2-7H3,(H,29,30)/t19-,21-,22-,23+/m1/s1 |
| InChIKey | OGJYZLGWLXXAAC-ADHNFCLRSA-N |
| XLogP | 5.12 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|