About 4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile
4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile (PubChem CID 101116784) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile |
| PubChem CID | 101116784 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=N/C[C@H]2CCCC[C@@H]2O)cc1 |
| InChI | InChI=1S/C15H18N2O/c16-9-12-5-7-13(8-6-12)10-17-11-14-3-1-2-4-15(14)18/h5-8,10,14-15,18H,1-4,11H2/b17-10+/t14-,15+/m1/s1 |
| InChIKey | DQPWOAODYMFAAP-BIJYSIMDSA-N |
| XLogP | 2.53 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile?
The IUPAC name of 4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile (CID 101116784) is 4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile.
What is the SMILES notation for 4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile?
The canonical SMILES for 4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile is N#Cc1ccc(/C=N/C[C@H]2CCCC[C@@H]2O)cc1.
What is the InChIKey of 4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile?
The InChIKey is DQPWOAODYMFAAP-BIJYSIMDSA-N. The full InChI is InChI=1S/C15H18N2O/c16-9-12-5-7-13(8-6-12)10-17-11-14-3-1-2-4-15(14)18/h5-8,10,14-15,18H,1-4,11H2/b17-10+/t14-,15+/m1/s1.
What are the key properties of 4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile?
4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile has a molecular weight of 242.32 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1R,2S)-2-hydroxycyclohexyl]methyliminomethyl]benzonitrile is sourced from PubChem (CID 101116784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).