About cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol
cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol (PubChem CID 101116786) has the molecular formula C14H18FNO
and a molecular weight of 235.30 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol |
| PubChem CID | 101116786 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1C/N=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FNO/c15-13-7-5-11(6-8-13)9-16-10-12-3-1-2-4-14(12)17/h5-9,12,14,17H,1-4,10H2/b16-9+/t12-,14+/m1/s1 |
| InChIKey | DUNMXUZIKQAKSP-YFQHGYJUSA-N |
| XLogP | 2.80 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol?
The IUPAC name of cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol (CID 101116786) is cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol.
What is the SMILES notation for cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol?
The canonical SMILES for cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol is O[C@H]1CCCC[C@@H]1C/N=C/c1ccc(F)cc1.
What is the InChIKey of cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol?
The InChIKey is DUNMXUZIKQAKSP-YFQHGYJUSA-N. The full InChI is InChI=1S/C14H18FNO/c15-13-7-5-11(6-8-13)9-16-10-12-3-1-2-4-14(12)17/h5-9,12,14,17H,1-4,10H2/b16-9+/t12-,14+/m1/s1.
What are the key properties of cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol?
cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol has a molecular weight of 235.30 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-[[(4-fluorophenyl)methylideneamino]methyl]cyclohexan-1-ol is sourced from PubChem (CID 101116786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).