C16H24N2O — CID 101116805
3-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazin-2-yl]-N,N-dimethylaniline (PubChem CID 101116805) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazin-2-yl]-N,N-dimethylaniline.
| Compound Name | 3-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazin-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101116805 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazin-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C2NC[C@H]3CCCC[C@@H]3O2)c1 |
| InChI | InChI=1S/C16H24N2O/c1-18(2)14-8-5-7-12(10-14)16-17-11-13-6-3-4-9-15(13)19-16/h5,7-8,10,13,15-17H,3-4,6,9,11H2,1-2H3/t13-,15+,16?/m1/s1 |
| InChIKey | SNHIUPFDNOQSKH-YISXUXMPSA-N |
| XLogP | 2.93 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |