C12H15NOSe — CID 101117217
(4R,6R)-6-methyl-2-(4-methylphenyl)-5,6-dihydro-4H-1,3-selenazin-4-ol (PubChem CID 101117217) has the molecular formula C12H15NOSe and a molecular weight of 268.22 g/mol. Its IUPAC name is (4R,6R)-6-methyl-2-(4-methylphenyl)-5,6-dihydro-4H-1,3-selenazin-4-ol.
| Compound Name | (4R,6R)-6-methyl-2-(4-methylphenyl)-5,6-dihydro-4H-1,3-selenazin-4-ol |
|---|---|
| PubChem CID | 101117217 |
| Molecular Formula | C12H15NOSe |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | (4R,6R)-6-methyl-2-(4-methylphenyl)-5,6-dihydro-4H-1,3-selenazin-4-ol |
| SMILES | Cc1ccc(C2=N[C@H](O)C[C@@H](C)[Se]2)cc1 |
| InChI | InChI=1S/C12H15NOSe/c1-8-3-5-10(6-4-8)12-13-11(14)7-9(2)15-12/h3-6,9,11,14H,7H2,1-2H3/t9-,11-/m1/s1 |
| InChIKey | FMRYZCWRFPIRFE-MWLCHTKSSA-N |
| XLogP | 1.98 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|