C26H42OS2 — CID 101117784
3-[(3E,7E,11E)-15-(1,3-dithian-2-ylidene)-3,7,12-trimethylpentadeca-3,7,11-trienyl]-2,2-dimethyloxirane (PubChem CID 101117784) has the molecular formula C26H42OS2 and a molecular weight of 434.76 g/mol. Its IUPAC name is 3-[(3E,7E,11E)-15-(1,3-dithian-2-ylidene)-3,7,12-trimethylpentadeca-3,7,11-trienyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(3E,7E,11E)-15-(1,3-dithian-2-ylidene)-3,7,12-trimethylpentadeca-3,7,11-trienyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 101117784 |
| Molecular Formula | C26H42OS2 |
| Molecular Weight | 434.76 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 3-[(3E,7E,11E)-15-(1,3-dithian-2-ylidene)-3,7,12-trimethylpentadeca-3,7,11-trienyl]-2,2-dimethyloxirane |
| SMILES | C/C(=C\CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C)CCC=C1SCCCS1 |
| InChI | InChI=1S/C26H42OS2/c1-21(13-8-14-23(3)17-18-24-26(4,5)27-24)11-6-7-12-22(2)15-9-16-25-28-19-10-20-29-25/h11-12,14,16,24H,6-10,13,15,17-20H2,1-5H3/b21-11+,22-12+,23-14+ |
| InChIKey | RZTAEDVSWDTYRW-NMDMJPEFSA-N |
| XLogP | 8.84 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.76 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|