C21H34OS2 — CID 101117786
3-[(3E,7E)-11-(1,3-dithian-2-ylidene)-3,7-dimethylundeca-3,7-dienyl]-2,2-dimethyloxirane (PubChem CID 101117786) has the molecular formula C21H34OS2 and a molecular weight of 366.64 g/mol. Its IUPAC name is 3-[(3E,7E)-11-(1,3-dithian-2-ylidene)-3,7-dimethylundeca-3,7-dienyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(3E,7E)-11-(1,3-dithian-2-ylidene)-3,7-dimethylundeca-3,7-dienyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 101117786 |
| Molecular Formula | C21H34OS2 |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 3-[(3E,7E)-11-(1,3-dithian-2-ylidene)-3,7-dimethylundeca-3,7-dienyl]-2,2-dimethyloxirane |
| SMILES | C/C(=C\CCC=C1SCCCS1)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C21H34OS2/c1-17(9-5-6-12-20-23-15-8-16-24-20)10-7-11-18(2)13-14-19-21(3,4)22-19/h9,11-12,19H,5-8,10,13-16H2,1-4H3/b17-9+,18-11+ |
| InChIKey | VYCKCXNYXOZVEQ-XURGJTJWSA-N |
| XLogP | 7.11 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|