C10H13N3O5 — CID 101118117
[(2R,3S,4S)-3-acetyloxy-4-azido-3,4-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 101118117) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is [(2R,3S,4S)-3-acetyloxy-4-azido-3,4-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S)-3-acetyloxy-4-azido-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101118117 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | [(2R,3S,4S)-3-acetyloxy-4-azido-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC=C[C@H](N=[N+]=[N-])[C@@H]1OC(C)=O |
| InChI | InChI=1S/C10H13N3O5/c1-6(14)17-5-9-10(18-7(2)15)8(12-13-11)3-4-16-9/h3-4,8-10H,5H2,1-2H3/t8-,9+,10-/m0/s1 |
| InChIKey | LMSCPFPKJAZEIU-AEJSXWLSSA-N |
| XLogP | 1.07 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|