About 1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide
1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide (PubChem CID 10111838) has the molecular formula C24H24N2O4
and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide |
| PubChem CID | 10111838 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide |
| SMILES | COc1cccc(CNC(=O)c2cccc(C(=O)NCc3cccc(OC)c3)c2)c1 |
| InChI | InChI=1S/C24H24N2O4/c1-29-21-10-3-6-17(12-21)15-25-23(27)19-8-5-9-20(14-19)24(28)26-16-18-7-4-11-22(13-18)30-2/h3-14H,15-16H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | XDBOLPFDJWTESQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide?
The IUPAC name of 1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide (CID 10111838) is 1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide.
What is the SMILES notation for 1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide?
The canonical SMILES for 1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide is COc1cccc(CNC(=O)c2cccc(C(=O)NCc3cccc(OC)c3)c2)c1.
What is the InChIKey of 1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide?
The InChIKey is XDBOLPFDJWTESQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2O4/c1-29-21-10-3-6-17(12-21)15-25-23(27)19-8-5-9-20(14-19)24(28)26-16-18-7-4-11-22(13-18)30-2/h3-14H,15-16H2,1-2H3,(H,25,27)(H,26,28).
What are the key properties of 1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide?
1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide has a molecular weight of 404.47 g/mol, XLogP of 3.56, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N-bis[(3-methoxyphenyl)methyl]benzene-1,3-dicarboxamide is sourced from PubChem (CID 10111838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).