C57H89N3O6 — CID 101118538
4-benzyl-3,5-bis(3,4,5-trihexoxyphenyl)-1,2,4-triazole (PubChem CID 101118538) has the molecular formula C57H89N3O6 and a molecular weight of 912.35 g/mol. Its IUPAC name is 4-benzyl-3,5-bis(3,4,5-trihexoxyphenyl)-1,2,4-triazole.
| Compound Name | 4-benzyl-3,5-bis(3,4,5-trihexoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 101118538 |
| Molecular Formula | C57H89N3O6 |
| Molecular Weight | 912.35 g/mol |
| Exact Mass | 911.68 |
| IUPAC Name | 4-benzyl-3,5-bis(3,4,5-trihexoxyphenyl)-1,2,4-triazole |
| SMILES | CCCCCCOc1cc(-c2nnc(-c3cc(OCCCCCC)c(OCCCCCC)c(OCCCCCC)c3)n2Cc2ccccc2)cc(OCCCCCC)c1OCCCCCC |
| InChI | InChI=1S/C57H89N3O6/c1-7-13-19-28-36-61-50-42-48(43-51(62-37-29-20-14-8-2)54(50)65-40-32-23-17-11-5)56-58-59-57(60(56)46-47-34-26-25-27-35-47)49-44-52(63-38-30-21-15-9-3)55(66-41-33-24-18-12-6)53(45-49)64-39-31-22-16-10-4/h25-27,34-35,42-45H,7-24,28-33,36-41,46H2,1-6H3 |
| InChIKey | XCSNHSZVWPKFCK-UHFFFAOYSA-N |
| XLogP | 16.42 |
| TPSA | 86.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.35 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|