C16H23NO7 — CID 101118546
3-(2-methoxyphenyl)-N-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide (PubChem CID 101118546) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-N-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide.
| Compound Name | 3-(2-methoxyphenyl)-N-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide |
|---|---|
| PubChem CID | 101118546 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-(2-methoxyphenyl)-N-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide |
| SMILES | COc1ccccc1CCC(=O)N[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H23NO7/c1-23-10-5-3-2-4-9(10)6-7-12(19)17-16-15(22)14(21)13(20)11(8-18)24-16/h2-5,11,13-16,18,20-22H,6-8H2,1H3,(H,17,19)/t11-,13+,14+,15-,16-/m1/s1 |
| InChIKey | DKFCLKYETQKZFW-DZQJYWQESA-N |
| XLogP | -1.46 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |