C11H11N3O3 — CID 101118935
4-phenyl-1-propanoyl-1,2,4-triazolidine-3,5-dione (PubChem CID 101118935) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 4-phenyl-1-propanoyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-phenyl-1-propanoyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 101118935 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 4-phenyl-1-propanoyl-1,2,4-triazolidine-3,5-dione |
| SMILES | CCC(=O)n1[nH]c(=O)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C11H11N3O3/c1-2-9(15)14-11(17)13(10(16)12-14)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,12,16) |
| InChIKey | HMBRUVFKFQIHBR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |