C22H16FN3O2S — CID 10111908
3-[(3-fluorophenyl)methyl]-1-methyl-6-(3-pyridin-3-ylprop-1-ynyl)thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 10111908) has the molecular formula C22H16FN3O2S and a molecular weight of 405.45 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methyl]-1-methyl-6-(3-pyridin-3-ylprop-1-ynyl)thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-[(3-fluorophenyl)methyl]-1-methyl-6-(3-pyridin-3-ylprop-1-ynyl)thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10111908 |
| Molecular Formula | C22H16FN3O2S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 3-[(3-fluorophenyl)methyl]-1-methyl-6-(3-pyridin-3-ylprop-1-ynyl)thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)n(Cc2cccc(F)c2)c(=O)c2cc(C#CCc3cccnc3)sc21 |
| InChI | InChI=1S/C22H16FN3O2S/c1-25-21-19(12-18(29-21)9-3-5-15-7-4-10-24-13-15)20(27)26(22(25)28)14-16-6-2-8-17(23)11-16/h2,4,6-8,10-13H,5,14H2,1H3 |
| InChIKey | WSDVOWFCLOIMHX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|