About (E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid
(E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid (PubChem CID 10112018) has the molecular formula C25H30N2O3
and a molecular weight of 406.53 g/mol. Its IUPAC name is (E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid |
| PubChem CID | 10112018 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid |
| SMILES | CCOc1c(-c2n[nH]c3ccc(/C(C)=C/C(=O)O)cc23)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C25H30N2O3/c1-7-30-25-19(15(4)5)12-18(14(2)3)13-21(25)24-20-11-17(16(6)10-23(28)29)8-9-22(20)26-27-24/h8-15H,7H2,1-6H3,(H,26,27)(H,28,29)/b16-10+ |
| InChIKey | LWXJNLCQFQPZKN-MHWRWJLKSA-N |
| XLogP | 6.36 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid?
The IUPAC name of (E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid (CID 10112018) is (E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid.
What is the SMILES notation for (E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid?
The canonical SMILES for (E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid is CCOc1c(-c2n[nH]c3ccc(/C(C)=C/C(=O)O)cc23)cc(C(C)C)cc1C(C)C.
What is the InChIKey of (E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid?
The InChIKey is LWXJNLCQFQPZKN-MHWRWJLKSA-N. The full InChI is InChI=1S/C25H30N2O3/c1-7-30-25-19(15(4)5)12-18(14(2)3)13-21(25)24-20-11-17(16(6)10-23(28)29)8-9-22(20)26-27-24/h8-15H,7H2,1-6H3,(H,26,27)(H,28,29)/b16-10+.
What are the key properties of (E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid?
(E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid has a molecular weight of 406.53 g/mol, XLogP of 6.36, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[3-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-1H-indazol-5-yl]but-2-enoic acid is sourced from PubChem (CID 10112018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).