C19H18F7NO2 — CID 101120423
(2E)-2-[[4-(dimethylamino)phenyl]methylidene]-6-(2,2,3,3,4,4,4-heptafluorobutanoyl)cyclohexan-1-one (PubChem CID 101120423) has the molecular formula C19H18F7NO2 and a molecular weight of 425.34 g/mol. Its IUPAC name is (2E)-2-[[4-(dimethylamino)phenyl]methylidene]-6-(2,2,3,3,4,4,4-heptafluorobutanoyl)cyclohexan-1-one.
| Compound Name | (2E)-2-[[4-(dimethylamino)phenyl]methylidene]-6-(2,2,3,3,4,4,4-heptafluorobutanoyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 101120423 |
| Molecular Formula | C19H18F7NO2 |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | (2E)-2-[[4-(dimethylamino)phenyl]methylidene]-6-(2,2,3,3,4,4,4-heptafluorobutanoyl)cyclohexan-1-one |
| SMILES | CN(C)c1ccc(/C=C2\CCCC(C(=O)C(F)(F)C(F)(F)C(F)(F)F)C2=O)cc1 |
| InChI | InChI=1S/C19H18F7NO2/c1-27(2)13-8-6-11(7-9-13)10-12-4-3-5-14(15(12)28)16(29)17(20,21)18(22,23)19(24,25)26/h6-10,14H,3-5H2,1-2H3/b12-10+ |
| InChIKey | BFULUJPNRCUZKR-ZRDIBKRKSA-N |
| XLogP | 4.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|