C13H13NO3 — CID 101120475
2-phenyl-6,7,9,9a-tetrahydro-[1,4]oxazino[3,4-b][1,3]oxazin-4-one (PubChem CID 101120475) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-phenyl-6,7,9,9a-tetrahydro-[1,4]oxazino[3,4-b][1,3]oxazin-4-one.
| Compound Name | 2-phenyl-6,7,9,9a-tetrahydro-[1,4]oxazino[3,4-b][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 101120475 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-phenyl-6,7,9,9a-tetrahydro-[1,4]oxazino[3,4-b][1,3]oxazin-4-one |
| SMILES | O=C1C=C(c2ccccc2)OC2COCCN12 |
| InChI | InChI=1S/C13H13NO3/c15-12-8-11(10-4-2-1-3-5-10)17-13-9-16-7-6-14(12)13/h1-5,8,13H,6-7,9H2 |
| InChIKey | LGJOXPLSQQYZJV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |