C17H24O3 — CID 101120539
(4'aR,8'S,8'aS)-3',5,5,8'-tetramethylspiro[1,3-dioxane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one (PubChem CID 101120539) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (4'aR,8'S,8'aS)-3',5,5,8'-tetramethylspiro[1,3-dioxane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one.
| Compound Name | (4'aR,8'S,8'aS)-3',5,5,8'-tetramethylspiro[1,3-dioxane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 101120539 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (4'aR,8'S,8'aS)-3',5,5,8'-tetramethylspiro[1,3-dioxane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one |
| SMILES | CC1=CC(=O)[C@@H]2[C@@H](CC=C[C@@H]2C)C12OCC(C)(C)CO2 |
| InChI | InChI=1S/C17H24O3/c1-11-6-5-7-13-15(11)14(18)8-12(2)17(13)19-9-16(3,4)10-20-17/h5-6,8,11,13,15H,7,9-10H2,1-4H3/t11-,13+,15-/m0/s1 |
| InChIKey | IZJGLBQJHOKGQN-LNSITVRQSA-N |
| XLogP | 3.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|