C10H21AsO10S — CID 101121413
3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-2,3,4-trihydroxyoxolan-2-yl]oxy-2-hydroxypropane-1-sulfonic acid (PubChem CID 101121413) has the molecular formula C10H21AsO10S and a molecular weight of 408.26 g/mol. Its IUPAC name is 3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-2,3,4-trihydroxyoxolan-2-yl]oxy-2-hydroxypropane-1-sulfonic acid.
| Compound Name | 3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-2,3,4-trihydroxyoxolan-2-yl]oxy-2-hydroxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 101121413 |
| Molecular Formula | C10H21AsO10S |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-2,3,4-trihydroxyoxolan-2-yl]oxy-2-hydroxypropane-1-sulfonic acid |
| SMILES | C[As](C)(=O)C[C@H]1O[C@](O)(OCC(O)CS(=O)(=O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H21AsO10S/c1-11(2,16)3-7-8(13)9(14)10(15,21-7)20-4-6(12)5-22(17,18)19/h6-9,12-15H,3-5H2,1-2H3,(H,17,18,19)/t6?,7-,8-,9-,10-/m1/s1 |
| InChIKey | IZKJFPOWICWVHQ-BHRXDNSCSA-N |
| XLogP | -2.35 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|