About 2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate
2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate (PubChem CID 10112190) has the molecular formula C23H27N3O2S
and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate.
Molecular Properties
| Compound Name | 2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate |
| PubChem CID | 10112190 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate |
| SMILES | CCCc1nccn1Cc1cccc(SCCOC(=O)Nc2ccccc2)c1C |
| InChI | InChI=1S/C23H27N3O2S/c1-3-8-22-24-13-14-26(22)17-19-9-7-12-21(18(19)2)29-16-15-28-23(27)25-20-10-5-4-6-11-20/h4-7,9-14H,3,8,15-17H2,1-2H3,(H,25,27) |
| InChIKey | NRMQQKAPXURDRR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate?
The IUPAC name of 2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate (CID 10112190) is 2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate.
What is the SMILES notation for 2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate?
The canonical SMILES for 2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate is CCCc1nccn1Cc1cccc(SCCOC(=O)Nc2ccccc2)c1C.
What is the InChIKey of 2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate?
The InChIKey is NRMQQKAPXURDRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O2S/c1-3-8-22-24-13-14-26(22)17-19-9-7-12-21(18(19)2)29-16-15-28-23(27)25-20-10-5-4-6-11-20/h4-7,9-14H,3,8,15-17H2,1-2H3,(H,25,27).
What are the key properties of 2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate?
2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate has a molecular weight of 409.56 g/mol, XLogP of 5.53, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-methyl-3-[(2-propylimidazol-1-yl)methyl]phenyl]sulfanylethyl N-phenylcarbamate is sourced from PubChem (CID 10112190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).