About 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid
2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid (PubChem CID 10112191) has the molecular formula C13H7ClF2INO2
and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid.
Molecular Properties
| Compound Name | 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid |
| PubChem CID | 10112191 |
| Molecular Formula | C13H7ClF2INO2 |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 408.92 |
| IUPAC Name | 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(F)c1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C13H7ClF2INO2/c14-8-5-6(17)1-4-10(8)18-12-7(13(19)20)2-3-9(15)11(12)16/h1-5,18H,(H,19,20) |
| InChIKey | XCNBGWKQXRQKSA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid?
The IUPAC name of 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid (CID 10112191) is 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid.
What is the SMILES notation for 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid?
The canonical SMILES for 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid is O=C(O)c1ccc(F)c(F)c1Nc1ccc(I)cc1Cl.
What is the InChIKey of 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid?
The InChIKey is XCNBGWKQXRQKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7ClF2INO2/c14-8-5-6(17)1-4-10(8)18-12-7(13(19)20)2-3-9(15)11(12)16/h1-5,18H,(H,19,20).
What are the key properties of 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid?
2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid has a molecular weight of 409.56 g/mol, XLogP of 4.66, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-4-iodoanilino)-3,4-difluorobenzoic acid is sourced from PubChem (CID 10112191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).