C18H21ClN5O2+ — CID 10112214
1-[5-amino-7-chloro-3-(cyclohexylamino)-2-(furan-2-yl)imidazo[1,2-a]pyrimidin-4-ium-1-yl]ethanone (PubChem CID 10112214) has the molecular formula C18H21ClN5O2+ and a molecular weight of 374.85 g/mol. Its IUPAC name is 1-[5-amino-7-chloro-3-(cyclohexylamino)-2-(furan-2-yl)imidazo[1,2-a]pyrimidin-4-ium-1-yl]ethanone.
| Compound Name | 1-[5-amino-7-chloro-3-(cyclohexylamino)-2-(furan-2-yl)imidazo[1,2-a]pyrimidin-4-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 10112214 |
| Molecular Formula | C18H21ClN5O2+ |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-[5-amino-7-chloro-3-(cyclohexylamino)-2-(furan-2-yl)imidazo[1,2-a]pyrimidin-4-ium-1-yl]ethanone |
| SMILES | CC(=O)n1c(-c2ccco2)c(NC2CCCCC2)[n+]2c(N)cc(Cl)nc12 |
| InChI | InChI=1S/C18H20ClN5O2/c1-11(25)23-16(13-8-5-9-26-13)17(21-12-6-3-2-4-7-12)24-15(20)10-14(19)22-18(23)24/h5,8-10,12,20-21H,2-4,6-7H2,1H3/p+1 |
| InChIKey | UYKMPKTVRHFUFG-UHFFFAOYSA-O |
| XLogP | 3.52 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|