About 2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate
2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate (PubChem CID 101122146) has the molecular formula C5H7Cl4NO3
and a molecular weight of 270.93 g/mol. Its IUPAC name is 2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate.
Molecular Properties
| Compound Name | 2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate |
| PubChem CID | 101122146 |
| Molecular Formula | C5H7Cl4NO3 |
| Molecular Weight | 270.93 g/mol |
| Exact Mass | 268.92 |
| IUPAC Name | 2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate |
| SMILES | O=C(NC(O)C(Cl)(Cl)Cl)OCCCl |
| InChI | InChI=1S/C5H7Cl4NO3/c6-1-2-13-4(12)10-3(11)5(7,8)9/h3,11H,1-2H2,(H,10,12) |
| InChIKey | POICKRFRYLVRKM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.93 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate?
The IUPAC name of 2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate (CID 101122146) is 2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate.
What is the SMILES notation for 2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate?
The canonical SMILES for 2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate is O=C(NC(O)C(Cl)(Cl)Cl)OCCCl.
What is the InChIKey of 2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate?
The InChIKey is POICKRFRYLVRKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7Cl4NO3/c6-1-2-13-4(12)10-3(11)5(7,8)9/h3,11H,1-2H2,(H,10,12).
What are the key properties of 2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate?
2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate has a molecular weight of 270.93 g/mol, XLogP of 1.64, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl N-(2,2,2-trichloro-1-hydroxyethyl)carbamate is sourced from PubChem (CID 101122146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).