About 1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene
1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene (PubChem CID 101122279) has the molecular formula C9H9Cl3O2
and a molecular weight of 255.53 g/mol. Its IUPAC name is 1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene.
Molecular Properties
| Compound Name | 1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene |
| PubChem CID | 101122279 |
| Molecular Formula | C9H9Cl3O2 |
| Molecular Weight | 255.53 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | 1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene |
| SMILES | COc1c(Cl)c(C)c(Cl)c(Cl)c1OC |
| InChI | InChI=1S/C9H9Cl3O2/c1-4-5(10)7(12)9(14-3)8(13-2)6(4)11/h1-3H3 |
| InChIKey | UQWSMMVQHDGODN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene?
The IUPAC name of 1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene (CID 101122279) is 1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene.
What is the SMILES notation for 1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene?
The canonical SMILES for 1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene is COc1c(Cl)c(C)c(Cl)c(Cl)c1OC.
What is the InChIKey of 1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene?
The InChIKey is UQWSMMVQHDGODN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl3O2/c1-4-5(10)7(12)9(14-3)8(13-2)6(4)11/h1-3H3.
What are the key properties of 1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene?
1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene has a molecular weight of 255.53 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,5-trichloro-3,4-dimethoxy-6-methylbenzene is sourced from PubChem (CID 101122279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).