C17H34NO8P — CID 10112279
2,2-di(pentanoyloxy)ethyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 10112279) has the molecular formula C17H34NO8P and a molecular weight of 411.43 g/mol. Its IUPAC name is 2,2-di(pentanoyloxy)ethyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | 2,2-di(pentanoyloxy)ethyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 10112279 |
| Molecular Formula | C17H34NO8P |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2,2-di(pentanoyloxy)ethyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC(=O)OC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC |
| InChI | InChI=1S/C17H34NO8P/c1-6-8-10-15(19)25-17(26-16(20)11-9-7-2)14-24-27(21,22)23-13-12-18(3,4)5/h17H,6-14H2,1-5H3 |
| InChIKey | NTBVHYHRAIRXRA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|