C20H20F3NO3S — CID 10112282
(11-benzyl-11-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-5-yl) trifluoromethanesulfonate (PubChem CID 10112282) has the molecular formula C20H20F3NO3S and a molecular weight of 411.45 g/mol. Its IUPAC name is (11-benzyl-11-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-5-yl) trifluoromethanesulfonate.
| Compound Name | (11-benzyl-11-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-5-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10112282 |
| Molecular Formula | C20H20F3NO3S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (11-benzyl-11-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-5-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)CC1CC2CN(Cc2ccccc2)C1)C(F)(F)F |
| InChI | InChI=1S/C20H20F3NO3S/c21-20(22,23)28(25,26)27-18-6-7-19-16(10-18)8-15-9-17(19)13-24(12-15)11-14-4-2-1-3-5-14/h1-7,10,15,17H,8-9,11-13H2 |
| InChIKey | MRLKQBTUVYSMFD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|