C13H18O5 — CID 101123059
ethyl (2R,3R)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3-[(E)-prop-1-enyl]oxirane-2-carboxylate (PubChem CID 101123059) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is ethyl (2R,3R)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3-[(E)-prop-1-enyl]oxirane-2-carboxylate.
| Compound Name | ethyl (2R,3R)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3-[(E)-prop-1-enyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 101123059 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | ethyl (2R,3R)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3-[(E)-prop-1-enyl]oxirane-2-carboxylate |
| SMILES | C/C=C/[C@H]1O[C@@]1(/C=C/C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C13H18O5/c1-4-7-10-13(18-10,12(15)17-6-3)9-8-11(14)16-5-2/h4,7-10H,5-6H2,1-3H3/b7-4+,9-8+/t10-,13-/m1/s1 |
| InChIKey | WERPAMKXTWSCSF-IQRUKPKBSA-N |
| XLogP | 1.38 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|