C26H42O4S — CID 101123111
(Z,4S)-5-methyl-7-methylsulfonyl-4-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]hept-5-en-2-one (PubChem CID 101123111) has the molecular formula C26H42O4S and a molecular weight of 450.69 g/mol. Its IUPAC name is (Z,4S)-5-methyl-7-methylsulfonyl-4-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]hept-5-en-2-one.
| Compound Name | (Z,4S)-5-methyl-7-methylsulfonyl-4-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]hept-5-en-2-one |
|---|---|
| PubChem CID | 101123111 |
| Molecular Formula | C26H42O4S |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | (Z,4S)-5-methyl-7-methylsulfonyl-4-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]hept-5-en-2-one |
| SMILES | CC(=O)C[C@H](O[C@@H](C)c1c(C(C)C)cc(C(C)C)cc1C(C)C)/C(C)=C\CS(C)(=O)=O |
| InChI | InChI=1S/C26H42O4S/c1-16(2)22-14-23(17(3)4)26(24(15-22)18(5)6)21(9)30-25(13-20(8)27)19(7)11-12-31(10,28)29/h11,14-18,21,25H,12-13H2,1-10H3/b19-11-/t21-,25-/m0/s1 |
| InChIKey | NESCFTJRCJFAEC-NPYWNRMPSA-N |
| XLogP | 6.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|