C11H8N4O — CID 101123211
5-pyrimidin-5-yl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (PubChem CID 101123211) has the molecular formula C11H8N4O and a molecular weight of 212.21 g/mol. Its IUPAC name is 5-pyrimidin-5-yl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 5-pyrimidin-5-yl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 101123211 |
| Molecular Formula | C11H8N4O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 5-pyrimidin-5-yl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| SMILES | O=C1Cc2cc(-c3cncnc3)cnc2N1 |
| InChI | InChI=1S/C11H8N4O/c16-10-2-7-1-8(5-14-11(7)15-10)9-3-12-6-13-4-9/h1,3-6H,2H2,(H,14,15,16) |
| InChIKey | FUMOIHGFKYUCKO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |