C18H26O2Si — CID 101123581
trimethyl-[(Z)-3-[(1S,2S,6R)-7-oxabicyclo[4.1.0]heptan-2-yl]-1-phenylprop-1-enoxy]silane (PubChem CID 101123581) has the molecular formula C18H26O2Si and a molecular weight of 302.49 g/mol. Its IUPAC name is trimethyl-[(Z)-3-[(1S,2S,6R)-7-oxabicyclo[4.1.0]heptan-2-yl]-1-phenylprop-1-enoxy]silane.
| Compound Name | trimethyl-[(Z)-3-[(1S,2S,6R)-7-oxabicyclo[4.1.0]heptan-2-yl]-1-phenylprop-1-enoxy]silane |
|---|---|
| PubChem CID | 101123581 |
| Molecular Formula | C18H26O2Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | trimethyl-[(Z)-3-[(1S,2S,6R)-7-oxabicyclo[4.1.0]heptan-2-yl]-1-phenylprop-1-enoxy]silane |
| SMILES | C[Si](C)(C)O/C(=C\C[C@@H]1CCC[C@H]2O[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C18H26O2Si/c1-21(2,3)20-16(14-8-5-4-6-9-14)13-12-15-10-7-11-17-18(15)19-17/h4-6,8-9,13,15,17-18H,7,10-12H2,1-3H3/b16-13-/t15-,17+,18-/m0/s1 |
| InChIKey | YJFZWCXVNDRXRN-IXWFRJPRSA-N |
| XLogP | 4.84 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|